C13H15ClN4O2 — CID 62165467
2-chloro-N-(5-methyl-1,2-oxazol-3-yl)-6-(propylamino)pyridine-4-carboxamide (PubChem CID 62165467) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is 2-chloro-N-(5-methyl-1,2-oxazol-3-yl)-6-(propylamino)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(5-methyl-1,2-oxazol-3-yl)-6-(propylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62165467 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-chloro-N-(5-methyl-1,2-oxazol-3-yl)-6-(propylamino)pyridine-4-carboxamide |
| SMILES | CCCNc1cc(C(=O)Nc2cc(C)on2)cc(Cl)n1 |
| InChI | InChI=1S/C13H15ClN4O2/c1-3-4-15-11-7-9(6-10(14)16-11)13(19)17-12-5-8(2)20-18-12/h5-7H,3-4H2,1-2H3,(H,15,16)(H,17,18,19) |
| InChIKey | DNVUTKKTWKLRJC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|