C14H15ClN2O4 — CID 39963862
3-chloro-4-ethoxy-5-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide (PubChem CID 39963862) has the molecular formula C14H15ClN2O4 and a molecular weight of 310.74 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-5-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide.
| Compound Name | 3-chloro-4-ethoxy-5-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 39963862 |
| Molecular Formula | C14H15ClN2O4 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-chloro-4-ethoxy-5-methoxy-N-(5-methyl-1,2-oxazol-3-yl)benzamide |
| SMILES | CCOc1c(Cl)cc(C(=O)Nc2cc(C)on2)cc1OC |
| InChI | InChI=1S/C14H15ClN2O4/c1-4-20-13-10(15)6-9(7-11(13)19-3)14(18)16-12-5-8(2)21-17-12/h5-7H,4H2,1-3H3,(H,16,17,18) |
| InChIKey | SKKBSDYDNGTGBH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |