C14H18ClN5O — CID 62167493
2-chloro-N-(2,5-dimethylpyrazol-3-yl)-6-(propylamino)pyridine-4-carboxamide (PubChem CID 62167493) has the molecular formula C14H18ClN5O and a molecular weight of 307.79 g/mol. Its IUPAC name is 2-chloro-N-(2,5-dimethylpyrazol-3-yl)-6-(propylamino)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(2,5-dimethylpyrazol-3-yl)-6-(propylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62167493 |
| Molecular Formula | C14H18ClN5O |
| Molecular Weight | 307.79 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-chloro-N-(2,5-dimethylpyrazol-3-yl)-6-(propylamino)pyridine-4-carboxamide |
| SMILES | CCCNc1cc(C(=O)Nc2cc(C)nn2C)cc(Cl)n1 |
| InChI | InChI=1S/C14H18ClN5O/c1-4-5-16-12-8-10(7-11(15)17-12)14(21)18-13-6-9(2)19-20(13)3/h6-8H,4-5H2,1-3H3,(H,16,17)(H,18,21) |
| InChIKey | AAJHNRQMNGMCJJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|