C9H10ClN5O — CID 90872001
2-chloro-6-(propylamino)pyridine-4-carbonyl azide (PubChem CID 90872001) has the molecular formula C9H10ClN5O and a molecular weight of 239.67 g/mol. Its IUPAC name is 2-chloro-6-(propylamino)pyridine-4-carbonyl azide.
| Compound Name | 2-chloro-6-(propylamino)pyridine-4-carbonyl azide |
|---|---|
| PubChem CID | 90872001 |
| Molecular Formula | C9H10ClN5O |
| Molecular Weight | 239.67 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-chloro-6-(propylamino)pyridine-4-carbonyl azide |
| SMILES | CCCNc1cc(C(=O)N=[N+]=[N-])cc(Cl)n1 |
| InChI | InChI=1S/C9H10ClN5O/c1-2-3-12-8-5-6(4-7(10)13-8)9(16)14-15-11/h4-5H,2-3H2,1H3,(H,12,13) |
| InChIKey | UQSSLMAKYMVLAV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.67 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|