C15H16N4OS — CID 17446454
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,3-dimethyl-1H-indole-5-carboxamide (PubChem CID 17446454) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,3-dimethyl-1H-indole-5-carboxamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,3-dimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 17446454 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,3-dimethyl-1H-indole-5-carboxamide |
| SMILES | CCc1nnc(NC(=O)c2ccc3[nH]c(C)c(C)c3c2)s1 |
| InChI | InChI=1S/C15H16N4OS/c1-4-13-18-19-15(21-13)17-14(20)10-5-6-12-11(7-10)8(2)9(3)16-12/h5-7,16H,4H2,1-3H3,(H,17,19,20) |
| InChIKey | GBSLAMGBOFEPGQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|