C18H26N2O — CID 63836824
N-(3-ethylpentan-2-yl)-2,3-dimethyl-1H-indole-5-carboxamide (PubChem CID 63836824) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is N-(3-ethylpentan-2-yl)-2,3-dimethyl-1H-indole-5-carboxamide.
| Compound Name | N-(3-ethylpentan-2-yl)-2,3-dimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 63836824 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | N-(3-ethylpentan-2-yl)-2,3-dimethyl-1H-indole-5-carboxamide |
| SMILES | CCC(CC)C(C)NC(=O)c1ccc2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C18H26N2O/c1-6-14(7-2)13(5)20-18(21)15-8-9-17-16(10-15)11(3)12(4)19-17/h8-10,13-14,19H,6-7H2,1-5H3,(H,20,21) |
| InChIKey | MVYPDFUDRTUXDA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|