C21H26N2O — CID 144948492
N-[(1S)-1-(4-ethylphenyl)ethyl]-2,3-dimethyl-1H-indole-5-carboxamide;molecular hydrogen (PubChem CID 144948492) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is N-[(1S)-1-(4-ethylphenyl)ethyl]-2,3-dimethyl-1H-indole-5-carboxamide;molecular hydrogen.
| Compound Name | N-[(1S)-1-(4-ethylphenyl)ethyl]-2,3-dimethyl-1H-indole-5-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 144948492 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-[(1S)-1-(4-ethylphenyl)ethyl]-2,3-dimethyl-1H-indole-5-carboxamide;molecular hydrogen |
| SMILES | CCc1ccc([C@H](C)NC(=O)c2ccc3[nH]c(C)c(C)c3c2)cc1.[H][H] |
| InChI | InChI=1S/C21H24N2O.H2/c1-5-16-6-8-17(9-7-16)15(4)23-21(24)18-10-11-20-19(12-18)13(2)14(3)22-20;/h6-12,15,22H,5H2,1-4H3,(H,23,24);1H/t15-;/m0./s1 |
| InChIKey | KXHZYLJTFFQQJL-RSAXXLAASA-N |
| XLogP | 5.08 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|