C14H16N2O4 — CID 43097887
2-[(2,3-dimethyl-1H-indole-5-carbonyl)amino]-3-hydroxypropanoic acid (PubChem CID 43097887) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-[(2,3-dimethyl-1H-indole-5-carbonyl)amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[(2,3-dimethyl-1H-indole-5-carbonyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 43097887 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-[(2,3-dimethyl-1H-indole-5-carbonyl)amino]-3-hydroxypropanoic acid |
| SMILES | Cc1[nH]c2ccc(C(=O)NC(CO)C(=O)O)cc2c1C |
| InChI | InChI=1S/C14H16N2O4/c1-7-8(2)15-11-4-3-9(5-10(7)11)13(18)16-12(6-17)14(19)20/h3-5,12,15,17H,6H2,1-2H3,(H,16,18)(H,19,20) |
| InChIKey | RMVFOUXGHYZNIH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|