C13H13N3O3S — CID 1091095
[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]phenyl] acetate (PubChem CID 1091095) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is [4-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]phenyl] acetate.
| Compound Name | [4-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 1091095 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | [4-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]phenyl] acetate |
| SMILES | CCc1nnc(NC(=O)c2ccc(OC(C)=O)cc2)s1 |
| InChI | InChI=1S/C13H13N3O3S/c1-3-11-15-16-13(20-11)14-12(18)9-4-6-10(7-5-9)19-8(2)17/h4-7H,3H2,1-2H3,(H,14,16,18) |
| InChIKey | FDHDLIRMSWOKTJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|