C13H13F2N3O2S — CID 9109400
4-(difluoromethoxy)-N-(5-propyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 9109400) has the molecular formula C13H13F2N3O2S and a molecular weight of 313.33 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-(5-propyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 4-(difluoromethoxy)-N-(5-propyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 9109400 |
| Molecular Formula | C13H13F2N3O2S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-(difluoromethoxy)-N-(5-propyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCc1nnc(NC(=O)c2ccc(OC(F)F)cc2)s1 |
| InChI | InChI=1S/C13H13F2N3O2S/c1-2-3-10-17-18-13(21-10)16-11(19)8-4-6-9(7-5-8)20-12(14)15/h4-7,12H,2-3H2,1H3,(H,16,18,19) |
| InChIKey | XWBNOWTUJZXGDF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |