C14H14F3N3O2S — CID 26197220
N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-(trifluoromethoxy)benzamide (PubChem CID 26197220) has the molecular formula C14H14F3N3O2S and a molecular weight of 345.35 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-(trifluoromethoxy)benzamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 26197220 |
| Molecular Formula | C14H14F3N3O2S |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-(trifluoromethoxy)benzamide |
| SMILES | CCCCc1nnc(NC(=O)c2ccc(OC(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C14H14F3N3O2S/c1-2-3-4-11-19-20-13(23-11)18-12(21)9-5-7-10(8-6-9)22-14(15,16)17/h5-8H,2-4H2,1H3,(H,18,20,21) |
| InChIKey | VQMZIHURADDPRH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |