C15H17F2N3O3S2 — CID 8839573
4-(difluoromethylsulfonyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 8839573) has the molecular formula C15H17F2N3O3S2 and a molecular weight of 389.45 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 8839573 |
| Molecular Formula | C15H17F2N3O3S2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCCCc1nnc(NC(=O)c2ccc(S(=O)(=O)C(F)F)cc2)s1 |
| InChI | InChI=1S/C15H17F2N3O3S2/c1-2-3-4-5-12-19-20-15(24-12)18-13(21)10-6-8-11(9-7-10)25(22,23)14(16)17/h6-9,14H,2-5H2,1H3,(H,18,20,21) |
| InChIKey | LUFWSPGEAMWBSV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|