C20H28N4O3S2 — CID 46551104
4-(cyclopropylsulfamoyl)-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 46551104) has the molecular formula C20H28N4O3S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 4-(cyclopropylsulfamoyl)-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 4-(cyclopropylsulfamoyl)-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 46551104 |
| Molecular Formula | C20H28N4O3S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 4-(cyclopropylsulfamoyl)-N-(5-octyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | CCCCCCCCc1nnc(NC(=O)c2ccc(S(=O)(=O)NC3CC3)cc2)s1 |
| InChI | InChI=1S/C20H28N4O3S2/c1-2-3-4-5-6-7-8-18-22-23-20(28-18)21-19(25)15-9-13-17(14-10-15)29(26,27)24-16-11-12-16/h9-10,13-14,16,24H,2-8,11-12H2,1H3,(H,21,23,25) |
| InChIKey | KDPIDDFEBLBJHY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|