C21H23N3O2 — CID 87040999
N-[3-(butanoylamino)phenyl]-2,3-dimethyl-1H-indole-5-carboxamide (PubChem CID 87040999) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-[3-(butanoylamino)phenyl]-2,3-dimethyl-1H-indole-5-carboxamide.
| Compound Name | N-[3-(butanoylamino)phenyl]-2,3-dimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 87040999 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-[3-(butanoylamino)phenyl]-2,3-dimethyl-1H-indole-5-carboxamide |
| SMILES | CCCC(=O)Nc1cccc(NC(=O)c2ccc3[nH]c(C)c(C)c3c2)c1 |
| InChI | InChI=1S/C21H23N3O2/c1-4-6-20(25)23-16-7-5-8-17(12-16)24-21(26)15-9-10-19-18(11-15)13(2)14(3)22-19/h5,7-12,22H,4,6H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | ZRGVURWFQDBJMT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|