C23H19FN2O2 — CID 129206342
4-[(2,3-dimethyl-1H-indol-5-yl)oxy]-N-(3-fluorophenyl)benzamide (PubChem CID 129206342) has the molecular formula C23H19FN2O2 and a molecular weight of 374.42 g/mol. Its IUPAC name is 4-[(2,3-dimethyl-1H-indol-5-yl)oxy]-N-(3-fluorophenyl)benzamide.
| Compound Name | 4-[(2,3-dimethyl-1H-indol-5-yl)oxy]-N-(3-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 129206342 |
| Molecular Formula | C23H19FN2O2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 4-[(2,3-dimethyl-1H-indol-5-yl)oxy]-N-(3-fluorophenyl)benzamide |
| SMILES | Cc1[nH]c2ccc(Oc3ccc(C(=O)Nc4cccc(F)c4)cc3)cc2c1C |
| InChI | InChI=1S/C23H19FN2O2/c1-14-15(2)25-22-11-10-20(13-21(14)22)28-19-8-6-16(7-9-19)23(27)26-18-5-3-4-17(24)12-18/h3-13,25H,1-2H3,(H,26,27) |
| InChIKey | QMGURGQGSHLKHZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|