C20H21N3O2 — CID 30378480
N-[3-(dimethylcarbamoyl)phenyl]-2,3-dimethyl-1H-indole-5-carboxamide (PubChem CID 30378480) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-[3-(dimethylcarbamoyl)phenyl]-2,3-dimethyl-1H-indole-5-carboxamide.
| Compound Name | N-[3-(dimethylcarbamoyl)phenyl]-2,3-dimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 30378480 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-[3-(dimethylcarbamoyl)phenyl]-2,3-dimethyl-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)Nc3cccc(C(=O)N(C)C)c3)cc2c1C |
| InChI | InChI=1S/C20H21N3O2/c1-12-13(2)21-18-9-8-14(11-17(12)18)19(24)22-16-7-5-6-15(10-16)20(25)23(3)4/h5-11,21H,1-4H3,(H,22,24) |
| InChIKey | KUTPRUSPMQOZQL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|