C22H24ClN3O2 — CID 34745053
N-[3-chloro-4-(diethylcarbamoyl)phenyl]-2,3-dimethyl-1H-indole-5-carboxamide (PubChem CID 34745053) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is N-[3-chloro-4-(diethylcarbamoyl)phenyl]-2,3-dimethyl-1H-indole-5-carboxamide.
| Compound Name | N-[3-chloro-4-(diethylcarbamoyl)phenyl]-2,3-dimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 34745053 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[3-chloro-4-(diethylcarbamoyl)phenyl]-2,3-dimethyl-1H-indole-5-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)c2ccc3[nH]c(C)c(C)c3c2)cc1Cl |
| InChI | InChI=1S/C22H24ClN3O2/c1-5-26(6-2)22(28)17-9-8-16(12-19(17)23)25-21(27)15-7-10-20-18(11-15)13(3)14(4)24-20/h7-12,24H,5-6H2,1-4H3,(H,25,27) |
| InChIKey | KWBWVRUZKMRLGN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|