C21H23ClN2O3 — CID 55673174
2-chloro-N,N-diethyl-4-[(4-prop-2-enoxybenzoyl)amino]benzamide (PubChem CID 55673174) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-4-[(4-prop-2-enoxybenzoyl)amino]benzamide.
| Compound Name | 2-chloro-N,N-diethyl-4-[(4-prop-2-enoxybenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 55673174 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-chloro-N,N-diethyl-4-[(4-prop-2-enoxybenzoyl)amino]benzamide |
| SMILES | C=CCOc1ccc(C(=O)Nc2ccc(C(=O)N(CC)CC)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H23ClN2O3/c1-4-13-27-17-10-7-15(8-11-17)20(25)23-16-9-12-18(19(22)14-16)21(26)24(5-2)6-3/h4,7-12,14H,1,5-6,13H2,2-3H3,(H,23,25) |
| InChIKey | FKBCPOLLVCHLTF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|