C22H23ClN4O2 — CID 34746028
2-chloro-N,N-diethyl-4-[[4-(5-methylpyrazol-1-yl)benzoyl]amino]benzamide (PubChem CID 34746028) has the molecular formula C22H23ClN4O2 and a molecular weight of 410.91 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-4-[[4-(5-methylpyrazol-1-yl)benzoyl]amino]benzamide.
| Compound Name | 2-chloro-N,N-diethyl-4-[[4-(5-methylpyrazol-1-yl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 34746028 |
| Molecular Formula | C22H23ClN4O2 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-chloro-N,N-diethyl-4-[[4-(5-methylpyrazol-1-yl)benzoyl]amino]benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)c2ccc(-n3nccc3C)cc2)cc1Cl |
| InChI | InChI=1S/C22H23ClN4O2/c1-4-26(5-2)22(29)19-11-8-17(14-20(19)23)25-21(28)16-6-9-18(10-7-16)27-15(3)12-13-24-27/h6-14H,4-5H2,1-3H3,(H,25,28) |
| InChIKey | HYFBAYWDDQXHHP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |