C24H21ClN4O3S — CID 35932965
N-[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]-4-(5-methylpyrazol-1-yl)benzamide (PubChem CID 35932965) has the molecular formula C24H21ClN4O3S and a molecular weight of 480.98 g/mol. Its IUPAC name is N-[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]-4-(5-methylpyrazol-1-yl)benzamide.
| Compound Name | N-[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]-4-(5-methylpyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 35932965 |
| Molecular Formula | C24H21ClN4O3S |
| Molecular Weight | 480.98 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N-[3-[(2-chlorophenyl)sulfamoyl]-4-methylphenyl]-4-(5-methylpyrazol-1-yl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(-n3nccc3C)cc2)cc1S(=O)(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C24H21ClN4O3S/c1-16-7-10-19(15-23(16)33(31,32)28-22-6-4-3-5-21(22)25)27-24(30)18-8-11-20(12-9-18)29-17(2)13-14-26-29/h3-15,28H,1-2H3,(H,27,30) |
| InChIKey | SHWHAFBNJPVIQR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.98 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |