C22H27N3O3S — CID 26759503
N-[3-(diethylsulfamoyl)-4-methylphenyl]-2,3-dimethyl-1H-indole-5-carboxamide (PubChem CID 26759503) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-2,3-dimethyl-1H-indole-5-carboxamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2,3-dimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 26759503 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2,3-dimethyl-1H-indole-5-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)c2ccc3[nH]c(C)c(C)c3c2)ccc1C |
| InChI | InChI=1S/C22H27N3O3S/c1-6-25(7-2)29(27,28)21-13-18(10-8-14(21)3)24-22(26)17-9-11-20-19(12-17)15(4)16(5)23-20/h8-13,23H,6-7H2,1-5H3,(H,24,26) |
| InChIKey | KHCJXCUCWCCESA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|