C21H23N3O4S — CID 39849550
N-[4-(diethylsulfamoyl)phenyl]-2-methyl-4-oxo-1H-quinoline-6-carboxamide (PubChem CID 39849550) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-2-methyl-4-oxo-1H-quinoline-6-carboxamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-2-methyl-4-oxo-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 39849550 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-2-methyl-4-oxo-1H-quinoline-6-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)c2ccc3[nH]c(C)cc(=O)c3c2)cc1 |
| InChI | InChI=1S/C21H23N3O4S/c1-4-24(5-2)29(27,28)17-9-7-16(8-10-17)23-21(26)15-6-11-19-18(13-15)20(25)12-14(3)22-19/h6-13H,4-5H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | KCDZYXZRIVXTIN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |