About N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide
N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide (PubChem CID 43430184) has the molecular formula C16H21N3O2
and a molecular weight of 287.36 g/mol. Its IUPAC name is N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide |
| PubChem CID | 43430184 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide |
| SMILES | CCN(CC(=O)NC)C(=O)c1ccc2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C16H21N3O2/c1-5-19(9-15(20)17-4)16(21)12-6-7-14-13(8-12)10(2)11(3)18-14/h6-8,18H,5,9H2,1-4H3,(H,17,20) |
| InChIKey | MWOGEOWCEWXWGV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide?
The IUPAC name of N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide (CID 43430184) is N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide.
What is the SMILES notation for N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide?
The canonical SMILES for N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide is CCN(CC(=O)NC)C(=O)c1ccc2[nH]c(C)c(C)c2c1.
What is the InChIKey of N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide?
The InChIKey is MWOGEOWCEWXWGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2/c1-5-19(9-15(20)17-4)16(21)12-6-7-14-13(8-12)10(2)11(3)18-14/h6-8,18H,5,9H2,1-4H3,(H,17,20).
What are the key properties of N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide?
N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide has a molecular weight of 287.36 g/mol, XLogP of 1.99, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide is sourced from PubChem (CID 43430184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).