C16H21N3O2 — CID 43430184
N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide (PubChem CID 43430184) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide.
| Compound Name | N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 43430184 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-ethyl-2,3-dimethyl-N-[2-(methylamino)-2-oxoethyl]-1H-indole-5-carboxamide |
| SMILES | CCN(CC(=O)NC)C(=O)c1ccc2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C16H21N3O2/c1-5-19(9-15(20)17-4)16(21)12-6-7-14-13(8-12)10(2)11(3)18-14/h6-8,18H,5,9H2,1-4H3,(H,17,20) |
| InChIKey | MWOGEOWCEWXWGV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|