C17H23N3O2 — CID 31750558
N,2,3-trimethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]-1H-indole-5-carboxamide (PubChem CID 31750558) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N,2,3-trimethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]-1H-indole-5-carboxamide.
| Compound Name | N,2,3-trimethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 31750558 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N,2,3-trimethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)N(C)CC(=O)NC(C)C)cc2c1C |
| InChI | InChI=1S/C17H23N3O2/c1-10(2)18-16(21)9-20(5)17(22)13-6-7-15-14(8-13)11(3)12(4)19-15/h6-8,10,19H,9H2,1-5H3,(H,18,21) |
| InChIKey | IKDBEBFDUDEBTB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|