C17H22N2O2 — CID 102684977
N-cyclobutyl-N-(2-hydroxyethyl)-2,3-dimethyl-1H-indole-5-carboxamide (PubChem CID 102684977) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-cyclobutyl-N-(2-hydroxyethyl)-2,3-dimethyl-1H-indole-5-carboxamide.
| Compound Name | N-cyclobutyl-N-(2-hydroxyethyl)-2,3-dimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 102684977 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-cyclobutyl-N-(2-hydroxyethyl)-2,3-dimethyl-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)N(CCO)C3CCC3)cc2c1C |
| InChI | InChI=1S/C17H22N2O2/c1-11-12(2)18-16-7-6-13(10-15(11)16)17(21)19(8-9-20)14-4-3-5-14/h6-7,10,14,18,20H,3-5,8-9H2,1-2H3 |
| InChIKey | ODABZARYVSNVCJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|