C19H24N2O2 — CID 87011207
N-cyclopropyl-2,3-dimethyl-N-(oxolan-3-ylmethyl)-1H-indole-5-carboxamide (PubChem CID 87011207) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-cyclopropyl-2,3-dimethyl-N-(oxolan-3-ylmethyl)-1H-indole-5-carboxamide.
| Compound Name | N-cyclopropyl-2,3-dimethyl-N-(oxolan-3-ylmethyl)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 87011207 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-cyclopropyl-2,3-dimethyl-N-(oxolan-3-ylmethyl)-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)N(CC3CCOC3)C3CC3)cc2c1C |
| InChI | InChI=1S/C19H24N2O2/c1-12-13(2)20-18-6-3-15(9-17(12)18)19(22)21(16-4-5-16)10-14-7-8-23-11-14/h3,6,9,14,16,20H,4-5,7-8,10-11H2,1-2H3 |
| InChIKey | AYRYQSXXUNINLV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|