C16H17F4NO2 — CID 95054883
N-cyclopropyl-4-fluoro-N-[[(3S)-oxolan-3-yl]methyl]-3-(trifluoromethyl)benzamide (PubChem CID 95054883) has the molecular formula C16H17F4NO2 and a molecular weight of 331.31 g/mol. Its IUPAC name is N-cyclopropyl-4-fluoro-N-[[(3S)-oxolan-3-yl]methyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-cyclopropyl-4-fluoro-N-[[(3S)-oxolan-3-yl]methyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 95054883 |
| Molecular Formula | C16H17F4NO2 |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-cyclopropyl-4-fluoro-N-[[(3S)-oxolan-3-yl]methyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(c1ccc(F)c(C(F)(F)F)c1)N(C[C@@H]1CCOC1)C1CC1 |
| InChI | InChI=1S/C16H17F4NO2/c17-14-4-1-11(7-13(14)16(18,19)20)15(22)21(12-2-3-12)8-10-5-6-23-9-10/h1,4,7,10,12H,2-3,5-6,8-9H2/t10-/m0/s1 |
| InChIKey | PJNCIOOFPFLAKJ-JTQLQIEISA-N |
| XLogP | 3.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |