C16H20N2O4 — CID 47922463
N-cyclopropyl-3-methyl-4-nitro-N-(oxolan-3-ylmethyl)benzamide (PubChem CID 47922463) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-cyclopropyl-3-methyl-4-nitro-N-(oxolan-3-ylmethyl)benzamide.
| Compound Name | N-cyclopropyl-3-methyl-4-nitro-N-(oxolan-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 47922463 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-cyclopropyl-3-methyl-4-nitro-N-(oxolan-3-ylmethyl)benzamide |
| SMILES | Cc1cc(C(=O)N(CC2CCOC2)C2CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N2O4/c1-11-8-13(2-5-15(11)18(20)21)16(19)17(14-3-4-14)9-12-6-7-22-10-12/h2,5,8,12,14H,3-4,6-7,9-10H2,1H3 |
| InChIKey | RMDDQUKAGDNTNR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|