C16H20N2OS — CID 43582046
N,2,3-trimethyl-N-(thiolan-3-yl)-1H-indole-5-carboxamide (PubChem CID 43582046) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is N,2,3-trimethyl-N-(thiolan-3-yl)-1H-indole-5-carboxamide.
| Compound Name | N,2,3-trimethyl-N-(thiolan-3-yl)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 43582046 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | N,2,3-trimethyl-N-(thiolan-3-yl)-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)N(C)C3CCSC3)cc2c1C |
| InChI | InChI=1S/C16H20N2OS/c1-10-11(2)17-15-5-4-12(8-14(10)15)16(19)18(3)13-6-7-20-9-13/h4-5,8,13,17H,6-7,9H2,1-3H3 |
| InChIKey | GAKFZKNAQUJSAM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|