C17H24N2O — CID 18164314
N-butyl-N-ethyl-2,3-dimethyl-1H-indole-5-carboxamide (PubChem CID 18164314) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is N-butyl-N-ethyl-2,3-dimethyl-1H-indole-5-carboxamide.
| Compound Name | N-butyl-N-ethyl-2,3-dimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 18164314 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N-butyl-N-ethyl-2,3-dimethyl-1H-indole-5-carboxamide |
| SMILES | CCCCN(CC)C(=O)c1ccc2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C17H24N2O/c1-5-7-10-19(6-2)17(20)14-8-9-16-15(11-14)12(3)13(4)18-16/h8-9,11,18H,5-7,10H2,1-4H3 |
| InChIKey | MQDXLZBJXWPJEU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|