C20H22N2O — CID 34909087
N,2,3-trimethyl-N-[(2-methylphenyl)methyl]-1H-indole-5-carboxamide (PubChem CID 34909087) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is N,2,3-trimethyl-N-[(2-methylphenyl)methyl]-1H-indole-5-carboxamide.
| Compound Name | N,2,3-trimethyl-N-[(2-methylphenyl)methyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 34909087 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N,2,3-trimethyl-N-[(2-methylphenyl)methyl]-1H-indole-5-carboxamide |
| SMILES | Cc1ccccc1CN(C)C(=O)c1ccc2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C20H22N2O/c1-13-7-5-6-8-17(13)12-22(4)20(23)16-9-10-19-18(11-16)14(2)15(3)21-19/h5-11,21H,12H2,1-4H3 |
| InChIKey | PEWZTYBQDCRDSF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|