C14H19N3O — CID 55023829
N-butyl-N-ethyl-1H-indazole-6-carboxamide (PubChem CID 55023829) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is N-butyl-N-ethyl-1H-indazole-6-carboxamide.
| Compound Name | N-butyl-N-ethyl-1H-indazole-6-carboxamide |
|---|---|
| PubChem CID | 55023829 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N-butyl-N-ethyl-1H-indazole-6-carboxamide |
| SMILES | CCCCN(CC)C(=O)c1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C14H19N3O/c1-3-5-8-17(4-2)14(18)11-6-7-12-10-15-16-13(12)9-11/h6-7,9-10H,3-5,8H2,1-2H3,(H,15,16) |
| InChIKey | HAAYUOWPGMGEFP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |