C19H25NO — CID 154151885
N,N-dibutylnaphthalene-2-carboxamide (PubChem CID 154151885) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is N,N-dibutylnaphthalene-2-carboxamide.
| Compound Name | N,N-dibutylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 154151885 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | N,N-dibutylnaphthalene-2-carboxamide |
| SMILES | CCCCN(CCCC)C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H25NO/c1-3-5-13-20(14-6-4-2)19(21)18-12-11-16-9-7-8-10-17(16)15-18/h7-12,15H,3-6,13-14H2,1-2H3 |
| InChIKey | FNYGHRORPATEMI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |