C16H26N2O — CID 28982328
4-amino-N,N-dibutyl-3-methylbenzamide (PubChem CID 28982328) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 4-amino-N,N-dibutyl-3-methylbenzamide.
| Compound Name | 4-amino-N,N-dibutyl-3-methylbenzamide |
|---|---|
| PubChem CID | 28982328 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 4-amino-N,N-dibutyl-3-methylbenzamide |
| SMILES | CCCCN(CCCC)C(=O)c1ccc(N)c(C)c1 |
| InChI | InChI=1S/C16H26N2O/c1-4-6-10-18(11-7-5-2)16(19)14-8-9-15(17)13(3)12-14/h8-9,12H,4-7,10-11,17H2,1-3H3 |
| InChIKey | PPSSLQYAIVZLHT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|