C12H13N5O3 — CID 62923706
N,N-bis(2-amino-2-oxoethyl)-1H-indazole-6-carboxamide (PubChem CID 62923706) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is N,N-bis(2-amino-2-oxoethyl)-1H-indazole-6-carboxamide.
| Compound Name | N,N-bis(2-amino-2-oxoethyl)-1H-indazole-6-carboxamide |
|---|---|
| PubChem CID | 62923706 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N,N-bis(2-amino-2-oxoethyl)-1H-indazole-6-carboxamide |
| SMILES | NC(=O)CN(CC(N)=O)C(=O)c1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C12H13N5O3/c13-10(18)5-17(6-11(14)19)12(20)7-1-2-8-4-15-16-9(8)3-7/h1-4H,5-6H2,(H2,13,18)(H2,14,19)(H,15,16) |
| InChIKey | GYAPAZDTUOOHNW-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 135.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |