C10H10N4O3 — CID 112674427
N-(2-amino-2-oxoethoxy)-1H-indazole-6-carboxamide (PubChem CID 112674427) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-1H-indazole-6-carboxamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-1H-indazole-6-carboxamide |
|---|---|
| PubChem CID | 112674427 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-1H-indazole-6-carboxamide |
| SMILES | NC(=O)CONC(=O)c1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C10H10N4O3/c11-9(15)5-17-14-10(16)6-1-2-7-4-12-13-8(7)3-6/h1-4H,5H2,(H2,11,15)(H,12,13)(H,14,16) |
| InChIKey | IVIOFFHJGPPGSH-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|