C12H16N4O — CID 65193937
N-(1-aminobutan-2-yl)-1H-indazole-6-carboxamide (PubChem CID 65193937) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is N-(1-aminobutan-2-yl)-1H-indazole-6-carboxamide.
| Compound Name | N-(1-aminobutan-2-yl)-1H-indazole-6-carboxamide |
|---|---|
| PubChem CID | 65193937 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | N-(1-aminobutan-2-yl)-1H-indazole-6-carboxamide |
| SMILES | CCC(CN)NC(=O)c1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C12H16N4O/c1-2-10(6-13)15-12(17)8-3-4-9-7-14-16-11(9)5-8/h3-5,7,10H,2,6,13H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | NSAYOOABRUPRIM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |