C12H17N3O2 — CID 65193984
3-N-(1-aminobutan-2-yl)benzene-1,3-dicarboxamide (PubChem CID 65193984) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 3-N-(1-aminobutan-2-yl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N-(1-aminobutan-2-yl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 65193984 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 3-N-(1-aminobutan-2-yl)benzene-1,3-dicarboxamide |
| SMILES | CCC(CN)NC(=O)c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C12H17N3O2/c1-2-10(7-13)15-12(17)9-5-3-4-8(6-9)11(14)16/h3-6,10H,2,7,13H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | BPDOUYNOZJRGIF-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |