C17H27N3O2 — CID 119585729
3-N-(1-amino-4-methylpentan-2-yl)-1-N-propylbenzene-1,3-dicarboxamide (PubChem CID 119585729) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 3-N-(1-amino-4-methylpentan-2-yl)-1-N-propylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-(1-amino-4-methylpentan-2-yl)-1-N-propylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 119585729 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 3-N-(1-amino-4-methylpentan-2-yl)-1-N-propylbenzene-1,3-dicarboxamide |
| SMILES | CCCNC(=O)c1cccc(C(=O)NC(CN)CC(C)C)c1 |
| InChI | InChI=1S/C17H27N3O2/c1-4-8-19-16(21)13-6-5-7-14(10-13)17(22)20-15(11-18)9-12(2)3/h5-7,10,12,15H,4,8-9,11,18H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | OJCMUSPFHRMYAZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |