C12H9N5O2 — CID 116787487
N-(6-oxo-1H-pyridazin-3-yl)-1H-indazole-6-carboxamide (PubChem CID 116787487) has the molecular formula C12H9N5O2 and a molecular weight of 255.24 g/mol. Its IUPAC name is N-(6-oxo-1H-pyridazin-3-yl)-1H-indazole-6-carboxamide.
| Compound Name | N-(6-oxo-1H-pyridazin-3-yl)-1H-indazole-6-carboxamide |
|---|---|
| PubChem CID | 116787487 |
| Molecular Formula | C12H9N5O2 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-(6-oxo-1H-pyridazin-3-yl)-1H-indazole-6-carboxamide |
| SMILES | O=C(Nc1ccc(=O)[nH]n1)c1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C12H9N5O2/c18-11-4-3-10(16-17-11)14-12(19)7-1-2-8-6-13-15-9(8)5-7/h1-6H,(H,13,15)(H,17,18)(H,14,16,19) |
| InChIKey | OIUVYWCZIHTTIA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |