C11H8FN3O2 — CID 116786641
4-fluoro-N-(6-oxo-1H-pyridazin-3-yl)benzamide (PubChem CID 116786641) has the molecular formula C11H8FN3O2 and a molecular weight of 233.20 g/mol. Its IUPAC name is 4-fluoro-N-(6-oxo-1H-pyridazin-3-yl)benzamide.
| Compound Name | 4-fluoro-N-(6-oxo-1H-pyridazin-3-yl)benzamide |
|---|---|
| PubChem CID | 116786641 |
| Molecular Formula | C11H8FN3O2 |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 4-fluoro-N-(6-oxo-1H-pyridazin-3-yl)benzamide |
| SMILES | O=C(Nc1ccc(=O)[nH]n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H8FN3O2/c12-8-3-1-7(2-4-8)11(17)13-9-5-6-10(16)15-14-9/h1-6H,(H,15,16)(H,13,14,17) |
| InChIKey | WMSBRPFIOGEHCW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |