C12H11ClN4O2 — CID 116786621
2-chloro-6-ethyl-N-(6-oxo-1H-pyridazin-3-yl)pyridine-4-carboxamide (PubChem CID 116786621) has the molecular formula C12H11ClN4O2 and a molecular weight of 278.70 g/mol. Its IUPAC name is 2-chloro-6-ethyl-N-(6-oxo-1H-pyridazin-3-yl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-ethyl-N-(6-oxo-1H-pyridazin-3-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 116786621 |
| Molecular Formula | C12H11ClN4O2 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-chloro-6-ethyl-N-(6-oxo-1H-pyridazin-3-yl)pyridine-4-carboxamide |
| SMILES | CCc1cc(C(=O)Nc2ccc(=O)[nH]n2)cc(Cl)n1 |
| InChI | InChI=1S/C12H11ClN4O2/c1-2-8-5-7(6-9(13)14-8)12(19)15-10-3-4-11(18)17-16-10/h3-6H,2H2,1H3,(H,17,18)(H,15,16,19) |
| InChIKey | ZWOXLZLOMSSBQX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|