C11H8Cl2N4O2 — CID 116786983
4-amino-3,5-dichloro-N-(6-oxo-1H-pyridazin-3-yl)benzamide (PubChem CID 116786983) has the molecular formula C11H8Cl2N4O2 and a molecular weight of 299.12 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-(6-oxo-1H-pyridazin-3-yl)benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-(6-oxo-1H-pyridazin-3-yl)benzamide |
|---|---|
| PubChem CID | 116786983 |
| Molecular Formula | C11H8Cl2N4O2 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 4-amino-3,5-dichloro-N-(6-oxo-1H-pyridazin-3-yl)benzamide |
| SMILES | Nc1c(Cl)cc(C(=O)Nc2ccc(=O)[nH]n2)cc1Cl |
| InChI | InChI=1S/C11H8Cl2N4O2/c12-6-3-5(4-7(13)10(6)14)11(19)15-8-1-2-9(18)17-16-8/h1-4H,14H2,(H,17,18)(H,15,16,19) |
| InChIKey | BRBGXXBPLCKJNN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|