C11H7Br2N3O2 — CID 114020151
2,4-dibromo-N-(6-oxo-1H-pyridazin-3-yl)benzamide (PubChem CID 114020151) has the molecular formula C11H7Br2N3O2 and a molecular weight of 373.00 g/mol. Its IUPAC name is 2,4-dibromo-N-(6-oxo-1H-pyridazin-3-yl)benzamide.
| Compound Name | 2,4-dibromo-N-(6-oxo-1H-pyridazin-3-yl)benzamide |
|---|---|
| PubChem CID | 114020151 |
| Molecular Formula | C11H7Br2N3O2 |
| Molecular Weight | 373.00 g/mol |
| Exact Mass | 370.89 |
| IUPAC Name | 2,4-dibromo-N-(6-oxo-1H-pyridazin-3-yl)benzamide |
| SMILES | O=C(Nc1ccc(=O)[nH]n1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H7Br2N3O2/c12-6-1-2-7(8(13)5-6)11(18)14-9-3-4-10(17)16-15-9/h1-5H,(H,16,17)(H,14,15,18) |
| InChIKey | KPFIIXZPFHGZNK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.00 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |