C9H6BrN3O2S — CID 116787231
3-bromo-N-(6-oxo-1H-pyridazin-3-yl)thiophene-2-carboxamide (PubChem CID 116787231) has the molecular formula C9H6BrN3O2S and a molecular weight of 300.14 g/mol. Its IUPAC name is 3-bromo-N-(6-oxo-1H-pyridazin-3-yl)thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-(6-oxo-1H-pyridazin-3-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 116787231 |
| Molecular Formula | C9H6BrN3O2S |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | 3-bromo-N-(6-oxo-1H-pyridazin-3-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(=O)[nH]n1)c1sccc1Br |
| InChI | InChI=1S/C9H6BrN3O2S/c10-5-3-4-16-8(5)9(15)11-6-1-2-7(14)13-12-6/h1-4H,(H,13,14)(H,11,12,15) |
| InChIKey | UHSZMHYTJWFVML-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |