C12H10BrN3O2 — CID 116787216
2-bromo-5-methyl-N-(6-oxo-1H-pyridazin-3-yl)benzamide (PubChem CID 116787216) has the molecular formula C12H10BrN3O2 and a molecular weight of 308.14 g/mol. Its IUPAC name is 2-bromo-5-methyl-N-(6-oxo-1H-pyridazin-3-yl)benzamide.
| Compound Name | 2-bromo-5-methyl-N-(6-oxo-1H-pyridazin-3-yl)benzamide |
|---|---|
| PubChem CID | 116787216 |
| Molecular Formula | C12H10BrN3O2 |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 2-bromo-5-methyl-N-(6-oxo-1H-pyridazin-3-yl)benzamide |
| SMILES | Cc1ccc(Br)c(C(=O)Nc2ccc(=O)[nH]n2)c1 |
| InChI | InChI=1S/C12H10BrN3O2/c1-7-2-3-9(13)8(6-7)12(18)14-10-4-5-11(17)16-15-10/h2-6H,1H3,(H,16,17)(H,14,15,18) |
| InChIKey | NFBZUZGTUPMULK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |