C14H10Cl3FN2O — CID 107573376
2-chloro-N-(3,5-dichloro-4-fluorophenyl)-6-ethylpyridine-4-carboxamide (PubChem CID 107573376) has the molecular formula C14H10Cl3FN2O and a molecular weight of 347.60 g/mol. Its IUPAC name is 2-chloro-N-(3,5-dichloro-4-fluorophenyl)-6-ethylpyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(3,5-dichloro-4-fluorophenyl)-6-ethylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 107573376 |
| Molecular Formula | C14H10Cl3FN2O |
| Molecular Weight | 347.60 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | 2-chloro-N-(3,5-dichloro-4-fluorophenyl)-6-ethylpyridine-4-carboxamide |
| SMILES | CCc1cc(C(=O)Nc2cc(Cl)c(F)c(Cl)c2)cc(Cl)n1 |
| InChI | InChI=1S/C14H10Cl3FN2O/c1-2-8-3-7(4-12(17)19-8)14(21)20-9-5-10(15)13(18)11(16)6-9/h3-6H,2H2,1H3,(H,20,21) |
| InChIKey | JZOIKHOCDIVBRV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|