C14H11N3O4 — CID 116787743
(E)-3-[4-[(6-oxo-1H-pyridazin-3-yl)carbamoyl]phenyl]prop-2-enoic acid (PubChem CID 116787743) has the molecular formula C14H11N3O4 and a molecular weight of 285.26 g/mol. Its IUPAC name is (E)-3-[4-[(6-oxo-1H-pyridazin-3-yl)carbamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(6-oxo-1H-pyridazin-3-yl)carbamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 116787743 |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | (E)-3-[4-[(6-oxo-1H-pyridazin-3-yl)carbamoyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(C(=O)Nc2ccc(=O)[nH]n2)cc1 |
| InChI | InChI=1S/C14H11N3O4/c18-12-7-6-11(16-17-12)15-14(21)10-4-1-9(2-5-10)3-8-13(19)20/h1-8H,(H,17,18)(H,19,20)(H,15,16,21)/b8-3+ |
| InChIKey | PDEQTMHJXNQGGJ-FPYGCLRLSA-N |
| XLogP | 1.12 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|