C24H22N2O — CID 129206265
4-[(2,3-dimethyl-1H-indol-5-yl)methyl]-N-phenylbenzamide (PubChem CID 129206265) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-[(2,3-dimethyl-1H-indol-5-yl)methyl]-N-phenylbenzamide.
| Compound Name | 4-[(2,3-dimethyl-1H-indol-5-yl)methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 129206265 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 4-[(2,3-dimethyl-1H-indol-5-yl)methyl]-N-phenylbenzamide |
| SMILES | Cc1[nH]c2ccc(Cc3ccc(C(=O)Nc4ccccc4)cc3)cc2c1C |
| InChI | InChI=1S/C24H22N2O/c1-16-17(2)25-23-13-10-19(15-22(16)23)14-18-8-11-20(12-9-18)24(27)26-21-6-4-3-5-7-21/h3-13,15,25H,14H2,1-2H3,(H,26,27) |
| InChIKey | ZNZBWKPXPNVPLU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|