C24H17Cl2NO — CID 59058109
4-[(6,7-dichloronaphthalen-2-yl)methyl]-N-phenylbenzamide (PubChem CID 59058109) has the molecular formula C24H17Cl2NO and a molecular weight of 406.31 g/mol. Its IUPAC name is 4-[(6,7-dichloronaphthalen-2-yl)methyl]-N-phenylbenzamide.
| Compound Name | 4-[(6,7-dichloronaphthalen-2-yl)methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 59058109 |
| Molecular Formula | C24H17Cl2NO |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 4-[(6,7-dichloronaphthalen-2-yl)methyl]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(Cc2ccc3cc(Cl)c(Cl)cc3c2)cc1 |
| InChI | InChI=1S/C24H17Cl2NO/c25-22-14-19-11-8-17(13-20(19)15-23(22)26)12-16-6-9-18(10-7-16)24(28)27-21-4-2-1-3-5-21/h1-11,13-15H,12H2,(H,27,28) |
| InChIKey | HKGOFXQCDOJRNZ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |